C9H9BrN4O2S — CID 103099058
5-bromo-1-(4-methylsulfonylphenyl)-1,2,4-triazol-3-amine (PubChem CID 103099058) has the molecular formula C9H9BrN4O2S and a molecular weight of 317.17 g/mol. Its IUPAC name is 5-bromo-1-(4-methylsulfonylphenyl)-1,2,4-triazol-3-amine.
| Compound Name | 5-bromo-1-(4-methylsulfonylphenyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 103099058 |
| Molecular Formula | C9H9BrN4O2S |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 5-bromo-1-(4-methylsulfonylphenyl)-1,2,4-triazol-3-amine |
| SMILES | CS(=O)(=O)c1ccc(-n2nc(N)nc2Br)cc1 |
| InChI | InChI=1S/C9H9BrN4O2S/c1-17(15,16)7-4-2-6(3-5-7)14-8(10)12-9(11)13-14/h2-5H,1H3,(H2,11,13) |
| InChIKey | HEWGTNKLQLDVFY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |