C9H6BrN7O2S — CID 103099233
2-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103099233) has the molecular formula C9H6BrN7O2S and a molecular weight of 356.17 g/mol. Its IUPAC name is 2-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103099233 |
| Molecular Formula | C9H6BrN7O2S |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 2-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(Cn2nc([N+](=O)[O-])nc2Br)nc2sccc12 |
| InChI | InChI=1S/C9H6BrN7O2S/c10-8-14-9(17(18)19)15-16(8)3-5-12-6(11)4-1-2-20-7(4)13-5/h1-2H,3H2,(H2,11,12,13) |
| InChIKey | JESIRNVEEXMIRP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|