C13H18N4OS — CID 103106749
2-[(4-amino-1,3-benzothiazol-5-yl)amino]-N-ethyl-N-methylpropanamide (PubChem CID 103106749) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[(4-amino-1,3-benzothiazol-5-yl)amino]-N-ethyl-N-methylpropanamide.
| Compound Name | 2-[(4-amino-1,3-benzothiazol-5-yl)amino]-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 103106749 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[(4-amino-1,3-benzothiazol-5-yl)amino]-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)Nc1ccc2scnc2c1N |
| InChI | InChI=1S/C13H18N4OS/c1-4-17(3)13(18)8(2)16-9-5-6-10-12(11(9)14)15-7-19-10/h5-8,16H,4,14H2,1-3H3 |
| InChIKey | XIMBWIKYVNCTIT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|