C11H14N4OS — CID 43566791
2-[(4-amino-1,3-benzothiazol-5-yl)amino]-N-ethylacetamide (PubChem CID 43566791) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-[(4-amino-1,3-benzothiazol-5-yl)amino]-N-ethylacetamide.
| Compound Name | 2-[(4-amino-1,3-benzothiazol-5-yl)amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 43566791 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-[(4-amino-1,3-benzothiazol-5-yl)amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNc1ccc2scnc2c1N |
| InChI | InChI=1S/C11H14N4OS/c1-2-13-9(16)5-14-7-3-4-8-11(10(7)12)15-6-17-8/h3-4,6,14H,2,5,12H2,1H3,(H,13,16) |
| InChIKey | OQNVXXHCKYTIAM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|