C10H9F4N3S — CID 114169082
5-N-(2,2,3,3-tetrafluoropropyl)-1,3-benzothiazole-4,5-diamine (PubChem CID 114169082) has the molecular formula C10H9F4N3S and a molecular weight of 279.26 g/mol. Its IUPAC name is 5-N-(2,2,3,3-tetrafluoropropyl)-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-(2,2,3,3-tetrafluoropropyl)-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 114169082 |
| Molecular Formula | C10H9F4N3S |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 5-N-(2,2,3,3-tetrafluoropropyl)-1,3-benzothiazole-4,5-diamine |
| SMILES | Nc1c(NCC(F)(F)C(F)F)ccc2scnc12 |
| InChI | InChI=1S/C10H9F4N3S/c11-9(12)10(13,14)3-16-5-1-2-6-8(7(5)15)17-4-18-6/h1-2,4,9,16H,3,15H2 |
| InChIKey | RRWIQLUTCSKDHI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|