C12H17N3OS — CID 107316527
5-[(4-amino-1,3-benzothiazol-5-yl)amino]pentan-1-ol (PubChem CID 107316527) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 5-[(4-amino-1,3-benzothiazol-5-yl)amino]pentan-1-ol.
| Compound Name | 5-[(4-amino-1,3-benzothiazol-5-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 107316527 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 5-[(4-amino-1,3-benzothiazol-5-yl)amino]pentan-1-ol |
| SMILES | Nc1c(NCCCCCO)ccc2scnc12 |
| InChI | InChI=1S/C12H17N3OS/c13-11-9(14-6-2-1-3-7-16)4-5-10-12(11)15-8-17-10/h4-5,8,14,16H,1-3,6-7,13H2 |
| InChIKey | BCJHVNHSHXKLHO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|