C14H20N4S — CID 105413922
5-N-[[1-(dimethylamino)cyclobutyl]methyl]-1,3-benzothiazole-4,5-diamine (PubChem CID 105413922) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is 5-N-[[1-(dimethylamino)cyclobutyl]methyl]-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-[[1-(dimethylamino)cyclobutyl]methyl]-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 105413922 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 5-N-[[1-(dimethylamino)cyclobutyl]methyl]-1,3-benzothiazole-4,5-diamine |
| SMILES | CN(C)C1(CNc2ccc3scnc3c2N)CCC1 |
| InChI | InChI=1S/C14H20N4S/c1-18(2)14(6-3-7-14)8-16-10-4-5-11-13(12(10)15)17-9-19-11/h4-5,9,16H,3,6-8,15H2,1-2H3 |
| InChIKey | AILJPHCAUFHWMC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|