C14H19N3S — CID 79861399
5-N-(2,2-dimethylcyclopentyl)-1,3-benzothiazole-4,5-diamine (PubChem CID 79861399) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 5-N-(2,2-dimethylcyclopentyl)-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-(2,2-dimethylcyclopentyl)-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 79861399 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 5-N-(2,2-dimethylcyclopentyl)-1,3-benzothiazole-4,5-diamine |
| SMILES | CC1(C)CCCC1Nc1ccc2scnc2c1N |
| InChI | InChI=1S/C14H19N3S/c1-14(2)7-3-4-11(14)17-9-5-6-10-13(12(9)15)16-8-18-10/h5-6,8,11,17H,3-4,7,15H2,1-2H3 |
| InChIKey | CQJYZVPKPYTEQD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|