C14H18N4S — CID 43451270
5-N-(1-azabicyclo[2.2.2]octan-3-yl)-1,3-benzothiazole-4,5-diamine (PubChem CID 43451270) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is 5-N-(1-azabicyclo[2.2.2]octan-3-yl)-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-(1-azabicyclo[2.2.2]octan-3-yl)-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 43451270 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 5-N-(1-azabicyclo[2.2.2]octan-3-yl)-1,3-benzothiazole-4,5-diamine |
| SMILES | Nc1c(NC2CN3CCC2CC3)ccc2scnc12 |
| InChI | InChI=1S/C14H18N4S/c15-13-10(1-2-12-14(13)16-8-19-12)17-11-7-18-5-3-9(11)4-6-18/h1-2,8-9,11,17H,3-7,15H2 |
| InChIKey | FJGZESNTCLOMMH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|