C11H20N6O2 — CID 103109183
2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-N-ethyl-N-methylpropanamide (PubChem CID 103109183) has the molecular formula C11H20N6O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-N-ethyl-N-methylpropanamide.
| Compound Name | 2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 103109183 |
| Molecular Formula | C11H20N6O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)NC(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C11H20N6O2/c1-4-16(3)11(19)8(2)13-10(18)7-17-6-9(5-12)14-15-17/h6,8H,4-5,7,12H2,1-3H3,(H,13,18) |
| InChIKey | JIJCGJYYTKWCEX-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |