C10H12N2O4 — CID 103119226
ethyl 4-(1-methylpyrazol-3-yl)-2,4-dioxobutanoate (PubChem CID 103119226) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is ethyl 4-(1-methylpyrazol-3-yl)-2,4-dioxobutanoate.
| Compound Name | ethyl 4-(1-methylpyrazol-3-yl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 103119226 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | ethyl 4-(1-methylpyrazol-3-yl)-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)c1ccn(C)n1 |
| InChI | InChI=1S/C10H12N2O4/c1-3-16-10(15)9(14)6-8(13)7-4-5-12(2)11-7/h4-5H,3,6H2,1-2H3 |
| InChIKey | PQGLVWOLESUGHF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|