C16H16N2O6S — CID 69379486
ethyl 4-[1-(4-methylphenyl)sulfonylpyrazol-3-yl]-2,4-dioxobutanoate (PubChem CID 69379486) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is ethyl 4-[1-(4-methylphenyl)sulfonylpyrazol-3-yl]-2,4-dioxobutanoate.
| Compound Name | ethyl 4-[1-(4-methylphenyl)sulfonylpyrazol-3-yl]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 69379486 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | ethyl 4-[1-(4-methylphenyl)sulfonylpyrazol-3-yl]-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)c1ccn(S(=O)(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C16H16N2O6S/c1-3-24-16(21)15(20)10-14(19)13-8-9-18(17-13)25(22,23)12-6-4-11(2)5-7-12/h4-9H,3,10H2,1-2H3 |
| InChIKey | BSOQOEIVLMDHAK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 112.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|