C11H12N2O4 — CID 23143526
ethyl 4-(5-methylpyrazin-2-yl)-2,4-dioxobutanoate (PubChem CID 23143526) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is ethyl 4-(5-methylpyrazin-2-yl)-2,4-dioxobutanoate.
| Compound Name | ethyl 4-(5-methylpyrazin-2-yl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 23143526 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | ethyl 4-(5-methylpyrazin-2-yl)-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)c1cnc(C)cn1 |
| InChI | InChI=1S/C11H12N2O4/c1-3-17-11(16)10(15)4-9(14)8-6-12-7(2)5-13-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | GQGCNOKXHMWGOO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|