C17H23N3O3S2 — CID 58084255
(NE,R)-2-methyl-N-[1-[1-(4-methylphenyl)sulfonylpyrazol-3-yl]propylidene]propane-2-sulfinamide (PubChem CID 58084255) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-[1-[1-(4-methylphenyl)sulfonylpyrazol-3-yl]propylidene]propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-[1-[1-(4-methylphenyl)sulfonylpyrazol-3-yl]propylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 58084255 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (NE,R)-2-methyl-N-[1-[1-(4-methylphenyl)sulfonylpyrazol-3-yl]propylidene]propane-2-sulfinamide |
| SMILES | CC/C(=N\[S@](=O)C(C)(C)C)c1ccn(S(=O)(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C17H23N3O3S2/c1-6-15(19-24(21)17(3,4)5)16-11-12-20(18-16)25(22,23)14-9-7-13(2)8-10-14/h7-12H,6H2,1-5H3/b19-15+/t24-/m1/s1 |
| InChIKey | JPTQHRATEKYAIQ-SIAYCOCNSA-N |
| XLogP | 3.09 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|