C12H12N2O4S — CID 71564627
1-(2,4-dimethylphenyl)sulfonylpyrazole-3-carboxylic acid (PubChem CID 71564627) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)sulfonylpyrazole-3-carboxylic acid.
| Compound Name | 1-(2,4-dimethylphenyl)sulfonylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 71564627 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 1-(2,4-dimethylphenyl)sulfonylpyrazole-3-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc(C(=O)O)n2)c(C)c1 |
| InChI | InChI=1S/C12H12N2O4S/c1-8-3-4-11(9(2)7-8)19(17,18)14-6-5-10(13-14)12(15)16/h3-7H,1-2H3,(H,15,16) |
| InChIKey | YRYWPSCJDQEVAS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |