C12H12ClNO2S — CID 175460039
3-chloro-1-(2,4-dimethylphenyl)sulfonylpyrrole (PubChem CID 175460039) has the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. Its IUPAC name is 3-chloro-1-(2,4-dimethylphenyl)sulfonylpyrrole.
| Compound Name | 3-chloro-1-(2,4-dimethylphenyl)sulfonylpyrrole |
|---|---|
| PubChem CID | 175460039 |
| Molecular Formula | C12H12ClNO2S |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 3-chloro-1-(2,4-dimethylphenyl)sulfonylpyrrole |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C12H12ClNO2S/c1-9-3-4-12(10(2)7-9)17(15,16)14-6-5-11(13)8-14/h3-8H,1-2H3 |
| InChIKey | DUWCRVPXSSCEPE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |