C29H36ClN7OS — CID 10312031
5-chloro-N-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide (PubChem CID 10312031) has the molecular formula C29H36ClN7OS and a molecular weight of 566.18 g/mol. Its IUPAC name is 5-chloro-N-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10312031 |
| Molecular Formula | C29H36ClN7OS |
| Molecular Weight | 566.18 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 5-chloro-N-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide |
| SMILES | CN(C)CCN(C)CCNC(=O)c1cnc(NNC(=S)NC2c3ccccc3CCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C29H36ClN7OS/c1-36(2)16-17-37(3)15-14-31-28(38)22-18-25(30)27(32-19-22)34-35-29(39)33-26-23-10-6-4-8-20(23)12-13-21-9-5-7-11-24(21)26/h4-11,18-19,26H,12-17H2,1-3H3,(H,31,38)(H,32,34)(H2,33,35,39) |
| InChIKey | YDPTYYIJRJMENX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|