C28H28ClN3O4S — CID 10196361
3-chloro-N-(1,1-dioxothiolan-3-yl)-4-[(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoylamino)methyl]benzamide (PubChem CID 10196361) has the molecular formula C28H28ClN3O4S and a molecular weight of 538.07 g/mol. Its IUPAC name is 3-chloro-N-(1,1-dioxothiolan-3-yl)-4-[(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoylamino)methyl]benzamide.
| Compound Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-4-[(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 10196361 |
| Molecular Formula | C28H28ClN3O4S |
| Molecular Weight | 538.07 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-4-[(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoylamino)methyl]benzamide |
| SMILES | O=C(NCc1ccc(C(=O)NC2CCS(=O)(=O)C2)cc1Cl)NC1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C28H28ClN3O4S/c29-25-15-20(27(33)31-22-13-14-37(35,36)17-22)11-12-21(25)16-30-28(34)32-26-23-7-3-1-5-18(23)9-10-19-6-2-4-8-24(19)26/h1-8,11-12,15,22,26H,9-10,13-14,16-17H2,(H,31,33)(H2,30,32,34) |
| InChIKey | PMPWRNAUCXYHGR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.07 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |