C18H20N2O4 — CID 10314425
3-benzoyl-N-(2,2-dimethoxyethyl)-N-methylpyridine-2-carboxamide (PubChem CID 10314425) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-benzoyl-N-(2,2-dimethoxyethyl)-N-methylpyridine-2-carboxamide.
| Compound Name | 3-benzoyl-N-(2,2-dimethoxyethyl)-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 10314425 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-benzoyl-N-(2,2-dimethoxyethyl)-N-methylpyridine-2-carboxamide |
| SMILES | COC(CN(C)C(=O)c1ncccc1C(=O)c1ccccc1)OC |
| InChI | InChI=1S/C18H20N2O4/c1-20(12-15(23-2)24-3)18(22)16-14(10-7-11-19-16)17(21)13-8-5-4-6-9-13/h4-11,15H,12H2,1-3H3 |
| InChIKey | CRSTWQJTICWXCW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|