C16H31F2NO2 — CID 103149793
3-(2,2-difluoroethoxy)-N-propyl-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-amine (PubChem CID 103149793) has the molecular formula C16H31F2NO2 and a molecular weight of 307.43 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-propyl-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-N-propyl-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 103149793 |
| Molecular Formula | C16H31F2NO2 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-propyl-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-amine |
| SMILES | CCCNC(CCOCC(F)F)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C16H31F2NO2/c1-6-8-19-13(7-9-20-11-14(17)18)12-10-15(2,3)21-16(12,4)5/h12-14,19H,6-11H2,1-5H3 |
| InChIKey | WIHWGYRACQVPCP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|