C14H25F4NO2 — CID 103475274
N-methyl-2-(2,2,3,3-tetrafluoropropoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine (PubChem CID 103475274) has the molecular formula C14H25F4NO2 and a molecular weight of 315.35 g/mol. Its IUPAC name is N-methyl-2-(2,2,3,3-tetrafluoropropoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine.
| Compound Name | N-methyl-2-(2,2,3,3-tetrafluoropropoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 103475274 |
| Molecular Formula | C14H25F4NO2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-methyl-2-(2,2,3,3-tetrafluoropropoxy)-1-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine |
| SMILES | CNC(COCC(F)(F)C(F)F)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C14H25F4NO2/c1-12(2)6-9(13(3,4)21-12)10(19-5)7-20-8-14(17,18)11(15)16/h9-11,19H,6-8H2,1-5H3 |
| InChIKey | ZMUZHFHGSJOQPJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|