C8H12F2N2OS — CID 103150105
[2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanamine (PubChem CID 103150105) has the molecular formula C8H12F2N2OS and a molecular weight of 222.26 g/mol. Its IUPAC name is [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 103150105 |
| Molecular Formula | C8H12F2N2OS |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanamine |
| SMILES | NCc1cnc(CCOCC(F)F)s1 |
| InChI | InChI=1S/C8H12F2N2OS/c9-7(10)5-13-2-1-8-12-4-6(3-11)14-8/h4,7H,1-3,5,11H2 |
| InChIKey | IEJBARIXXMCJRC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|