C7H14N2O5 — CID 103156723
2-[(4-amino-3-methoxybutanoyl)amino]oxyacetic acid (PubChem CID 103156723) has the molecular formula C7H14N2O5 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-[(4-amino-3-methoxybutanoyl)amino]oxyacetic acid.
| Compound Name | 2-[(4-amino-3-methoxybutanoyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 103156723 |
| Molecular Formula | C7H14N2O5 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-[(4-amino-3-methoxybutanoyl)amino]oxyacetic acid |
| SMILES | COC(CN)CC(=O)NOCC(=O)O |
| InChI | InChI=1S/C7H14N2O5/c1-13-5(3-8)2-6(10)9-14-4-7(11)12/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | VSFQZNUYVGVURI-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|