C18H14N3O3S+ — CID 10315929
3-(4-methoxyphenyl)-4-(2-phenyl-1,3-thiazol-4-yl)-2H-oxadiazol-3-ium-5-one (PubChem CID 10315929) has the molecular formula C18H14N3O3S+ and a molecular weight of 352.40 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-(2-phenyl-1,3-thiazol-4-yl)-2H-oxadiazol-3-ium-5-one.
| Compound Name | 3-(4-methoxyphenyl)-4-(2-phenyl-1,3-thiazol-4-yl)-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 10315929 |
| Molecular Formula | C18H14N3O3S+ |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-(2-phenyl-1,3-thiazol-4-yl)-2H-oxadiazol-3-ium-5-one |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2-c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H13N3O3S/c1-23-14-9-7-13(8-10-14)21-16(18(22)24-20-21)15-11-25-17(19-15)12-5-3-2-4-6-12/h2-11H,1H3/p+1 |
| InChIKey | UMDSPBHZISJBQN-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|