C16H25NOS — CID 103159831
1-cyclopentyl-3-[cyclopropyl(thiophen-3-ylmethyl)amino]propan-2-ol (PubChem CID 103159831) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is 1-cyclopentyl-3-[cyclopropyl(thiophen-3-ylmethyl)amino]propan-2-ol.
| Compound Name | 1-cyclopentyl-3-[cyclopropyl(thiophen-3-ylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 103159831 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1-cyclopentyl-3-[cyclopropyl(thiophen-3-ylmethyl)amino]propan-2-ol |
| SMILES | OC(CC1CCCC1)CN(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C16H25NOS/c18-16(9-13-3-1-2-4-13)11-17(15-5-6-15)10-14-7-8-19-12-14/h7-8,12-13,15-16,18H,1-6,9-11H2 |
| InChIKey | VOZLAZPNNFBFID-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |