C13H19N5O2 — CID 103172723
N-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-(triazol-1-yl)propan-1-amine (PubChem CID 103172723) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is N-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-(triazol-1-yl)propan-1-amine.
| Compound Name | N-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-(triazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 103172723 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-(triazol-1-yl)propan-1-amine |
| SMILES | COc1ccnc(CNCCCn2ccnn2)c1OC |
| InChI | InChI=1S/C13H19N5O2/c1-19-12-4-6-15-11(13(12)20-2)10-14-5-3-8-18-9-7-16-17-18/h4,6-7,9,14H,3,5,8,10H2,1-2H3 |
| InChIKey | IOFRALZEWABVJJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|