C13H21ClN2O2 — CID 103174030
2-chloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]pentan-1-amine (PubChem CID 103174030) has the molecular formula C13H21ClN2O2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 2-chloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]pentan-1-amine.
| Compound Name | 2-chloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 103174030 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-chloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]pentan-1-amine |
| SMILES | CCCC(Cl)CNCc1nccc(OC)c1OC |
| InChI | InChI=1S/C13H21ClN2O2/c1-4-5-10(14)8-15-9-11-13(18-3)12(17-2)6-7-16-11/h6-7,10,15H,4-5,8-9H2,1-3H3 |
| InChIKey | RMVVSQHMIBRNNU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|