C22H34O5 — CID 10317520
methyl [(1R,3S,5S,8E,12S,13R,16S)-5,9,12,13-tetramethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-en-16-yl]methyl carbonate (PubChem CID 10317520) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is methyl [(1R,3S,5S,8E,12S,13R,16S)-5,9,12,13-tetramethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-en-16-yl]methyl carbonate.
| Compound Name | methyl [(1R,3S,5S,8E,12S,13R,16S)-5,9,12,13-tetramethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-en-16-yl]methyl carbonate |
|---|---|
| PubChem CID | 10317520 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | methyl [(1R,3S,5S,8E,12S,13R,16S)-5,9,12,13-tetramethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-en-16-yl]methyl carbonate |
| SMILES | COC(=O)OC[C@H]1[C@H]2CC[C@@H](C)[C@]1(C)CC/C(C)=C/CC[C@]1(C)O[C@@H]1C2=O |
| InChI | InChI=1S/C22H34O5/c1-14-7-6-11-22(4)19(27-22)18(23)16-9-8-15(2)21(3,12-10-14)17(16)13-26-20(24)25-5/h7,15-17,19H,6,8-13H2,1-5H3/b14-7+/t15-,16-,17+,19-,21+,22+/m1/s1 |
| InChIKey | RQDZXPQYSVFAFX-CXCVCXIFSA-N |
| XLogP | 4.68 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|