C27H36O5 — CID 10765571
phenyl [(1R,3S,5R,8E,12S,13R,16S)-5,9,12,13-tetramethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-en-16-yl]methyl carbonate (PubChem CID 10765571) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is phenyl [(1R,3S,5R,8E,12S,13R,16S)-5,9,12,13-tetramethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-en-16-yl]methyl carbonate.
| Compound Name | phenyl [(1R,3S,5R,8E,12S,13R,16S)-5,9,12,13-tetramethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-en-16-yl]methyl carbonate |
|---|---|
| PubChem CID | 10765571 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | phenyl [(1R,3S,5R,8E,12S,13R,16S)-5,9,12,13-tetramethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-en-16-yl]methyl carbonate |
| SMILES | C/C1=C\CC[C@@]2(C)O[C@@H]2C(=O)[C@@H]2CC[C@@H](C)[C@](C)(CC1)[C@H]2COC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C27H36O5/c1-18-9-8-15-27(4)24(32-27)23(28)21-13-12-19(2)26(3,16-14-18)22(21)17-30-25(29)31-20-10-6-5-7-11-20/h5-7,9-11,19,21-22,24H,8,12-17H2,1-4H3/b18-9+/t19-,21-,22+,24-,26+,27-/m1/s1 |
| InChIKey | AVFNXDMKAUKSEC-JGOJIRBSSA-N |
| XLogP | 6.12 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|