C19H18O6S — CID 54043254
[(2S,4S)-4-(phenoxycarbonyloxymethyl)thietan-2-yl]methyl phenyl carbonate (PubChem CID 54043254) has the molecular formula C19H18O6S and a molecular weight of 374.41 g/mol. Its IUPAC name is [(2S,4S)-4-(phenoxycarbonyloxymethyl)thietan-2-yl]methyl phenyl carbonate.
| Compound Name | [(2S,4S)-4-(phenoxycarbonyloxymethyl)thietan-2-yl]methyl phenyl carbonate |
|---|---|
| PubChem CID | 54043254 |
| Molecular Formula | C19H18O6S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [(2S,4S)-4-(phenoxycarbonyloxymethyl)thietan-2-yl]methyl phenyl carbonate |
| SMILES | O=C(OC[C@@H]1C[C@@H](COC(=O)Oc2ccccc2)S1)Oc1ccccc1 |
| InChI | InChI=1S/C19H18O6S/c20-18(24-14-7-3-1-4-8-14)22-12-16-11-17(26-16)13-23-19(21)25-15-9-5-2-6-10-15/h1-10,16-17H,11-13H2/t16-,17-/m0/s1 |
| InChIKey | LNUYRULIDQXXDU-IRXDYDNUSA-N |
| XLogP | 4.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|