C10H10O2S2 — CID 23338919
phenyl 1,3-dithiolane-2-carboxylate (PubChem CID 23338919) has the molecular formula C10H10O2S2 and a molecular weight of 226.32 g/mol. Its IUPAC name is phenyl 1,3-dithiolane-2-carboxylate.
| Compound Name | phenyl 1,3-dithiolane-2-carboxylate |
|---|---|
| PubChem CID | 23338919 |
| Molecular Formula | C10H10O2S2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | phenyl 1,3-dithiolane-2-carboxylate |
| SMILES | O=C(Oc1ccccc1)C1SCCS1 |
| InChI | InChI=1S/C10H10O2S2/c11-9(10-13-6-7-14-10)12-8-4-2-1-3-5-8/h1-5,10H,6-7H2 |
| InChIKey | XCAXDSVBWCYQBE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|