C12H17N3O2S2 — CID 103180181
2-[2-(3-methoxypropoxy)ethylsulfanyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103180181) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[2-(3-methoxypropoxy)ethylsulfanyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[2-(3-methoxypropoxy)ethylsulfanyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103180181 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-[2-(3-methoxypropoxy)ethylsulfanyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COCCCOCCSc1nc(N)c2ccsc2n1 |
| InChI | InChI=1S/C12H17N3O2S2/c1-16-4-2-5-17-6-8-19-12-14-10(13)9-3-7-18-11(9)15-12/h3,7H,2,4-6,8H2,1H3,(H2,13,14,15) |
| InChIKey | UWSXOPGNSBKGST-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|