About 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide
3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide (PubChem CID 60728043) has the molecular formula C11H13N5O2S2
and a molecular weight of 311.39 g/mol. Its IUPAC name is 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide.
Molecular Properties
| Compound Name | 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide |
| PubChem CID | 60728043 |
| Molecular Formula | C11H13N5O2S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)CCSc1nc(N)c2ccsc2n1 |
| InChI | InChI=1S/C11H13N5O2S2/c1-13-10(18)14-7(17)3-5-20-11-15-8(12)6-2-4-19-9(6)16-11/h2,4H,3,5H2,1H3,(H2,12,15,16)(H2,13,14,17,18) |
| InChIKey | CVPMURVYVGYEQD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide?
The IUPAC name of 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide (CID 60728043) is 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide.
What is the SMILES notation for 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide?
The canonical SMILES for 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide is CNC(=O)NC(=O)CCSc1nc(N)c2ccsc2n1.
What is the InChIKey of 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide?
The InChIKey is CVPMURVYVGYEQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O2S2/c1-13-10(18)14-7(17)3-5-20-11-15-8(12)6-2-4-19-9(6)16-11/h2,4H,3,5H2,1H3,(H2,12,15,16)(H2,13,14,17,18).
What are the key properties of 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide?
3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide has a molecular weight of 311.39 g/mol, XLogP of 1.21, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide is sourced from PubChem (CID 60728043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).