C11H11N5OS2 — CID 51264258
2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2-cyanoethyl)acetamide (PubChem CID 51264258) has the molecular formula C11H11N5OS2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 51264258 |
| Molecular Formula | C11H11N5OS2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2-cyanoethyl)acetamide |
| SMILES | N#CCCNC(=O)CSc1nc(N)c2ccsc2n1 |
| InChI | InChI=1S/C11H11N5OS2/c12-3-1-4-14-8(17)6-19-11-15-9(13)7-2-5-18-10(7)16-11/h2,5H,1,4,6H2,(H,14,17)(H2,13,15,16) |
| InChIKey | LZWIWKZJCSIYRS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|