C25H25N5 — CID 10318534
5-[2-(2-azidophenyl)ethylamino]-2,2-diphenylpentanenitrile (PubChem CID 10318534) has the molecular formula C25H25N5 and a molecular weight of 395.51 g/mol. Its IUPAC name is 5-[2-(2-azidophenyl)ethylamino]-2,2-diphenylpentanenitrile.
| Compound Name | 5-[2-(2-azidophenyl)ethylamino]-2,2-diphenylpentanenitrile |
|---|---|
| PubChem CID | 10318534 |
| Molecular Formula | C25H25N5 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 5-[2-(2-azidophenyl)ethylamino]-2,2-diphenylpentanenitrile |
| SMILES | N#CC(CCCNCCc1ccccc1N=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25N5/c26-20-25(22-11-3-1-4-12-22,23-13-5-2-6-14-23)17-9-18-28-19-16-21-10-7-8-15-24(21)29-30-27/h1-8,10-15,28H,9,16-19H2 |
| InChIKey | CNVIEHBUWKCWKL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|