C12H29N3O2S — CID 103192324
N-[1-(dimethylamino)propan-2-yl]-N-ethyl-1-(ethylamino)propane-2-sulfonamide (PubChem CID 103192324) has the molecular formula C12H29N3O2S and a molecular weight of 279.45 g/mol. Its IUPAC name is N-[1-(dimethylamino)propan-2-yl]-N-ethyl-1-(ethylamino)propane-2-sulfonamide.
| Compound Name | N-[1-(dimethylamino)propan-2-yl]-N-ethyl-1-(ethylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 103192324 |
| Molecular Formula | C12H29N3O2S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N-[1-(dimethylamino)propan-2-yl]-N-ethyl-1-(ethylamino)propane-2-sulfonamide |
| SMILES | CCNCC(C)S(=O)(=O)N(CC)C(C)CN(C)C |
| InChI | InChI=1S/C12H29N3O2S/c1-7-13-9-12(4)18(16,17)15(8-2)11(3)10-14(5)6/h11-13H,7-10H2,1-6H3 |
| InChIKey | DKWXPXWEPRXYPM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |