C11H27N3O3S — CID 103192205
3-[[1-(dimethylamino)propan-2-yl-ethylsulfamoyl]-methylamino]propan-1-ol (PubChem CID 103192205) has the molecular formula C11H27N3O3S and a molecular weight of 281.42 g/mol. Its IUPAC name is 3-[[1-(dimethylamino)propan-2-yl-ethylsulfamoyl]-methylamino]propan-1-ol.
| Compound Name | 3-[[1-(dimethylamino)propan-2-yl-ethylsulfamoyl]-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 103192205 |
| Molecular Formula | C11H27N3O3S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 3-[[1-(dimethylamino)propan-2-yl-ethylsulfamoyl]-methylamino]propan-1-ol |
| SMILES | CCN(C(C)CN(C)C)S(=O)(=O)N(C)CCCO |
| InChI | InChI=1S/C11H27N3O3S/c1-6-14(11(2)10-12(3)4)18(16,17)13(5)8-7-9-15/h11,15H,6-10H2,1-5H3 |
| InChIKey | OQPWLYWDUWECMM-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |