C9H19N3O2S — CID 103188946
1-cyano-N-[1-(dimethylamino)propan-2-yl]-N-ethylmethanesulfonamide (PubChem CID 103188946) has the molecular formula C9H19N3O2S and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-cyano-N-[1-(dimethylamino)propan-2-yl]-N-ethylmethanesulfonamide.
| Compound Name | 1-cyano-N-[1-(dimethylamino)propan-2-yl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 103188946 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-cyano-N-[1-(dimethylamino)propan-2-yl]-N-ethylmethanesulfonamide |
| SMILES | CCN(C(C)CN(C)C)S(=O)(=O)CC#N |
| InChI | InChI=1S/C9H19N3O2S/c1-5-12(9(2)8-11(3)4)15(13,14)7-6-10/h9H,5,7-8H2,1-4H3 |
| InChIKey | XAGVVTYJOICYFS-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |