C10H25N3O2S — CID 103188523
1-amino-N-[1-(dimethylamino)propan-2-yl]-N-ethylpropane-2-sulfonamide (PubChem CID 103188523) has the molecular formula C10H25N3O2S and a molecular weight of 251.40 g/mol. Its IUPAC name is 1-amino-N-[1-(dimethylamino)propan-2-yl]-N-ethylpropane-2-sulfonamide.
| Compound Name | 1-amino-N-[1-(dimethylamino)propan-2-yl]-N-ethylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 103188523 |
| Molecular Formula | C10H25N3O2S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 1-amino-N-[1-(dimethylamino)propan-2-yl]-N-ethylpropane-2-sulfonamide |
| SMILES | CCN(C(C)CN(C)C)S(=O)(=O)C(C)CN |
| InChI | InChI=1S/C10H25N3O2S/c1-6-13(9(2)8-12(4)5)16(14,15)10(3)7-11/h9-10H,6-8,11H2,1-5H3 |
| InChIKey | LZLWFXRDMRHGSK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |