C13H24F3N3O2 — CID 103205473
1-[4-(1-amino-2-methylpropan-2-yl)piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103205473) has the molecular formula C13H24F3N3O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 1-[4-(1-amino-2-methylpropan-2-yl)piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-[4-(1-amino-2-methylpropan-2-yl)piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103205473 |
| Molecular Formula | C13H24F3N3O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 1-[4-(1-amino-2-methylpropan-2-yl)piperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | CC(C)(CN)N1CCN(C(=O)CCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H24F3N3O2/c1-12(2,9-17)19-6-4-18(5-7-19)11(20)3-8-21-10-13(14,15)16/h3-10,17H2,1-2H3 |
| InChIKey | DKFBWXNLNBOJRH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|