C10H16F3N3O3 — CID 103209534
1-[3-(2,2,2-trifluoroethoxy)propanoyl]piperazine-2-carboxamide (PubChem CID 103209534) has the molecular formula C10H16F3N3O3 and a molecular weight of 283.25 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propanoyl]piperazine-2-carboxamide.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propanoyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 103209534 |
| Molecular Formula | C10H16F3N3O3 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propanoyl]piperazine-2-carboxamide |
| SMILES | NC(=O)C1CNCCN1C(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O3/c11-10(12,13)6-19-4-1-8(17)16-3-2-15-5-7(16)9(14)18/h7,15H,1-6H2,(H2,14,18) |
| InChIKey | QJXCLSXVYKCAPP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|