C11H19F3N2O2 — CID 103212944
1-(3-amino-3-propan-2-ylazetidin-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103212944) has the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-(3-amino-3-propan-2-ylazetidin-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(3-amino-3-propan-2-ylazetidin-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103212944 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(3-amino-3-propan-2-ylazetidin-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | CC(C)C1(N)CN(C(=O)CCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H19F3N2O2/c1-8(2)10(15)5-16(6-10)9(17)3-4-18-7-11(12,13)14/h8H,3-7,15H2,1-2H3 |
| InChIKey | OHKDZOUNPSPXTD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|