C12H22F2N2O2 — CID 103206903
3-(2,2-difluoroethoxy)-N-(1-piperidin-2-ylethyl)propanamide (PubChem CID 103206903) has the molecular formula C12H22F2N2O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-(1-piperidin-2-ylethyl)propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-(1-piperidin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 103206903 |
| Molecular Formula | C12H22F2N2O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-(1-piperidin-2-ylethyl)propanamide |
| SMILES | CC(NC(=O)CCOCC(F)F)C1CCCCN1 |
| InChI | InChI=1S/C12H22F2N2O2/c1-9(10-4-2-3-6-15-10)16-12(17)5-7-18-8-11(13)14/h9-11,15H,2-8H2,1H3,(H,16,17) |
| InChIKey | UJVJDEIOXAOUFE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|