C9H16F2N2O2S — CID 103208322
N-(1-amino-1-sulfanylidenebutan-2-yl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103208322) has the molecular formula C9H16F2N2O2S and a molecular weight of 254.30 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenebutan-2-yl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(1-amino-1-sulfanylidenebutan-2-yl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103208322 |
| Molecular Formula | C9H16F2N2O2S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-(1-amino-1-sulfanylidenebutan-2-yl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | CCC(NC(=O)CCOCC(F)F)C(N)=S |
| InChI | InChI=1S/C9H16F2N2O2S/c1-2-6(9(12)16)13-8(14)3-4-15-5-7(10)11/h6-7H,2-5H2,1H3,(H2,12,16)(H,13,14) |
| InChIKey | XMLMQZLBBAHRMK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|