C12H11F3N2O4 — CID 103211923
(E)-3-[6-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]-2-pyridinyl]prop-2-enoic acid (PubChem CID 103211923) has the molecular formula C12H11F3N2O4 and a molecular weight of 304.22 g/mol. Its IUPAC name is (E)-3-[6-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]-2-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103211923 |
| Molecular Formula | C12H11F3N2O4 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (E)-3-[6-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]-2-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(NC(=O)COCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H11F3N2O4/c13-12(14,15)7-21-6-10(18)17-9-3-1-2-8(16-9)4-5-11(19)20/h1-5H,6-7H2,(H,19,20)(H,16,17,18)/b5-4+ |
| InChIKey | NYBRZUCKYHAZLZ-SNAWJCMRSA-N |
| XLogP | 1.70 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|