C10H16F3N3O2 — CID 103213632
[4-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol (PubChem CID 103213632) has the molecular formula C10H16F3N3O2 and a molecular weight of 267.25 g/mol. Its IUPAC name is [4-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol.
| Compound Name | [4-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 103213632 |
| Molecular Formula | C10H16F3N3O2 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | [4-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazol-3-yl]methanol |
| SMILES | CC(C)n1c(CO)nnc1CCOCC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O2/c1-7(2)16-8(14-15-9(16)5-17)3-4-18-6-10(11,12)13/h7,17H,3-6H2,1-2H3 |
| InChIKey | NWGOQVADFGQWFA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|