C9H13F2N3O — CID 103213658
4-cyclopropyl-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-triazole (PubChem CID 103213658) has the molecular formula C9H13F2N3O and a molecular weight of 217.22 g/mol. Its IUPAC name is 4-cyclopropyl-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-triazole.
| Compound Name | 4-cyclopropyl-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 103213658 |
| Molecular Formula | C9H13F2N3O |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 4-cyclopropyl-3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-triazole |
| SMILES | FC(F)COCCc1nncn1C1CC1 |
| InChI | InChI=1S/C9H13F2N3O/c10-8(11)5-15-4-3-9-13-12-6-14(9)7-1-2-7/h6-8H,1-5H2 |
| InChIKey | SYDDKXLXLNKQIM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|