C13H19F3N2O — CID 103213732
4,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1H-benzimidazole (PubChem CID 103213732) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is 4,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1H-benzimidazole.
| Compound Name | 4,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 103213732 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydro-1H-benzimidazole |
| SMILES | CC1Cc2[nH]c(CCOCC(F)(F)F)nc2C(C)C1 |
| InChI | InChI=1S/C13H19F3N2O/c1-8-5-9(2)12-10(6-8)17-11(18-12)3-4-19-7-13(14,15)16/h8-9H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | AJIYLILDSRXTFH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|