C14H16ClIN2S — CID 103215960
1-(3-chloro-4-iodophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-N-methylethanamine (PubChem CID 103215960) has the molecular formula C14H16ClIN2S and a molecular weight of 406.72 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-N-methylethanamine.
| Compound Name | 1-(3-chloro-4-iodophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 103215960 |
| Molecular Formula | C14H16ClIN2S |
| Molecular Weight | 406.72 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-N-methylethanamine |
| SMILES | CNC(Cc1nc(C)c(C)s1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClIN2S/c1-8-9(2)19-14(18-8)7-13(17-3)10-4-5-12(16)11(15)6-10/h4-6,13,17H,7H2,1-3H3 |
| InChIKey | VUROEGXTKPEHPM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|