C15H17Cl2IN2O — CID 103216924
2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(3-chloro-4-iodophenyl)ethanol (PubChem CID 103216924) has the molecular formula C15H17Cl2IN2O and a molecular weight of 439.12 g/mol. Its IUPAC name is 2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(3-chloro-4-iodophenyl)ethanol.
| Compound Name | 2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(3-chloro-4-iodophenyl)ethanol |
|---|---|
| PubChem CID | 103216924 |
| Molecular Formula | C15H17Cl2IN2O |
| Molecular Weight | 439.12 g/mol |
| Exact Mass | 437.98 |
| IUPAC Name | 2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(3-chloro-4-iodophenyl)ethanol |
| SMILES | CCc1nn(CC)c(CC(O)c2ccc(I)c(Cl)c2)c1Cl |
| InChI | InChI=1S/C15H17Cl2IN2O/c1-3-12-15(17)13(20(4-2)19-12)8-14(21)9-5-6-11(18)10(16)7-9/h5-7,14,21H,3-4,8H2,1-2H3 |
| InChIKey | BKTDRNIMSDQAQP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.12 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|